C24H27N3O5S — CID 2489407
methyl 2-[[2-[4-oxo-3-(3-propan-2-yloxypropyl)quinazolin-2-yl]sulfanylacetyl]amino]benzoate (PubChem CID 2489407) has the molecular formula C24H27N3O5S and a molecular weight of 469.56 g/mol. Its IUPAC name is methyl 2-[[2-[4-oxo-3-(3-propan-2-yloxypropyl)quinazolin-2-yl]sulfanylacetyl]amino]benzoate.
| Compound Name | methyl 2-[[2-[4-oxo-3-(3-propan-2-yloxypropyl)quinazolin-2-yl]sulfanylacetyl]amino]benzoate |
|---|---|
| PubChem CID | 2489407 |
| Molecular Formula | C24H27N3O5S |
| Molecular Weight | 469.56 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | methyl 2-[[2-[4-oxo-3-(3-propan-2-yloxypropyl)quinazolin-2-yl]sulfanylacetyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)CSc1nc2ccccc2c(=O)n1CCCOC(C)C |
| InChI | InChI=1S/C24H27N3O5S/c1-16(2)32-14-8-13-27-22(29)17-9-4-6-11-19(17)26-24(27)33-15-21(28)25-20-12-7-5-10-18(20)23(30)31-3/h4-7,9-12,16H,8,13-15H2,1-3H3,(H,25,28) |
| InChIKey | IQSQEVNVTODXEC-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.56 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|