C26H37N3O3S — CID 3181435
N,N-dicyclohexyl-2-[3-(3-methoxypropyl)-4-oxoquinazolin-2-yl]sulfanylacetamide (PubChem CID 3181435) has the molecular formula C26H37N3O3S and a molecular weight of 471.67 g/mol. Its IUPAC name is N,N-dicyclohexyl-2-[3-(3-methoxypropyl)-4-oxoquinazolin-2-yl]sulfanylacetamide.
| Compound Name | N,N-dicyclohexyl-2-[3-(3-methoxypropyl)-4-oxoquinazolin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 3181435 |
| Molecular Formula | C26H37N3O3S |
| Molecular Weight | 471.67 g/mol |
| Exact Mass | 471.26 |
| IUPAC Name | N,N-dicyclohexyl-2-[3-(3-methoxypropyl)-4-oxoquinazolin-2-yl]sulfanylacetamide |
| SMILES | COCCCn1c(SCC(=O)N(C2CCCCC2)C2CCCCC2)nc2ccccc2c1=O |
| InChI | InChI=1S/C26H37N3O3S/c1-32-18-10-17-28-25(31)22-15-8-9-16-23(22)27-26(28)33-19-24(30)29(20-11-4-2-5-12-20)21-13-6-3-7-14-21/h8-9,15-16,20-21H,2-7,10-14,17-19H2,1H3 |
| InChIKey | NYOZLCYHPRRYEP-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.67 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|