C22H30ClN3O3S — CID 55311914
2-[7-chloro-3-(3-methoxypropyl)-4-oxoquinazolin-2-yl]sulfanyl-N-cyclohexyl-N-ethylacetamide (PubChem CID 55311914) has the molecular formula C22H30ClN3O3S and a molecular weight of 452.02 g/mol. Its IUPAC name is 2-[7-chloro-3-(3-methoxypropyl)-4-oxoquinazolin-2-yl]sulfanyl-N-cyclohexyl-N-ethylacetamide.
| Compound Name | 2-[7-chloro-3-(3-methoxypropyl)-4-oxoquinazolin-2-yl]sulfanyl-N-cyclohexyl-N-ethylacetamide |
|---|---|
| PubChem CID | 55311914 |
| Molecular Formula | C22H30ClN3O3S |
| Molecular Weight | 452.02 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | 2-[7-chloro-3-(3-methoxypropyl)-4-oxoquinazolin-2-yl]sulfanyl-N-cyclohexyl-N-ethylacetamide |
| SMILES | CCN(C(=O)CSc1nc2cc(Cl)ccc2c(=O)n1CCCOC)C1CCCCC1 |
| InChI | InChI=1S/C22H30ClN3O3S/c1-3-25(17-8-5-4-6-9-17)20(27)15-30-22-24-19-14-16(23)10-11-18(19)21(28)26(22)12-7-13-29-2/h10-11,14,17H,3-9,12-13,15H2,1-2H3 |
| InChIKey | HVXFCRDLWOTVKY-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.02 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|