C20H28ClN3O2S — CID 112777929
7-chloro-3-(3-methoxypropyl)-2-[2-(1-methylpiperidin-2-yl)ethylsulfanyl]quinazolin-4-one (PubChem CID 112777929) has the molecular formula C20H28ClN3O2S and a molecular weight of 409.98 g/mol. Its IUPAC name is 7-chloro-3-(3-methoxypropyl)-2-[2-(1-methylpiperidin-2-yl)ethylsulfanyl]quinazolin-4-one.
| Compound Name | 7-chloro-3-(3-methoxypropyl)-2-[2-(1-methylpiperidin-2-yl)ethylsulfanyl]quinazolin-4-one |
|---|---|
| PubChem CID | 112777929 |
| Molecular Formula | C20H28ClN3O2S |
| Molecular Weight | 409.98 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | 7-chloro-3-(3-methoxypropyl)-2-[2-(1-methylpiperidin-2-yl)ethylsulfanyl]quinazolin-4-one |
| SMILES | COCCCn1c(SCCC2CCCCN2C)nc2cc(Cl)ccc2c1=O |
| InChI | InChI=1S/C20H28ClN3O2S/c1-23-10-4-3-6-16(23)9-13-27-20-22-18-14-15(21)7-8-17(18)19(25)24(20)11-5-12-26-2/h7-8,14,16H,3-6,9-13H2,1-2H3 |
| InChIKey | NAZMBYKUQAWICE-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.98 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|