C20H29N3O2S — CID 112776663
3-(3-methoxypropyl)-2-[2-(1-methylpiperidin-2-yl)ethylsulfanyl]quinazolin-4-one (PubChem CID 112776663) has the molecular formula C20H29N3O2S and a molecular weight of 375.54 g/mol. Its IUPAC name is 3-(3-methoxypropyl)-2-[2-(1-methylpiperidin-2-yl)ethylsulfanyl]quinazolin-4-one.
| Compound Name | 3-(3-methoxypropyl)-2-[2-(1-methylpiperidin-2-yl)ethylsulfanyl]quinazolin-4-one |
|---|---|
| PubChem CID | 112776663 |
| Molecular Formula | C20H29N3O2S |
| Molecular Weight | 375.54 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | 3-(3-methoxypropyl)-2-[2-(1-methylpiperidin-2-yl)ethylsulfanyl]quinazolin-4-one |
| SMILES | COCCCn1c(SCCC2CCCCN2C)nc2ccccc2c1=O |
| InChI | InChI=1S/C20H29N3O2S/c1-22-12-6-5-8-16(22)11-15-26-20-21-18-10-4-3-9-17(18)19(24)23(20)13-7-14-25-2/h3-4,9-10,16H,5-8,11-15H2,1-2H3 |
| InChIKey | QLLPBNACVDJYTC-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.54 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|