C21H20Cl2N2O4S — CID 33335742
7-chloro-2-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methylsulfanyl]-3-(3-methoxypropyl)quinazolin-4-one (PubChem CID 33335742) has the molecular formula C21H20Cl2N2O4S and a molecular weight of 467.37 g/mol. Its IUPAC name is 7-chloro-2-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methylsulfanyl]-3-(3-methoxypropyl)quinazolin-4-one.
| Compound Name | 7-chloro-2-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methylsulfanyl]-3-(3-methoxypropyl)quinazolin-4-one |
|---|---|
| PubChem CID | 33335742 |
| Molecular Formula | C21H20Cl2N2O4S |
| Molecular Weight | 467.37 g/mol |
| Exact Mass | 466.05 |
| IUPAC Name | 7-chloro-2-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methylsulfanyl]-3-(3-methoxypropyl)quinazolin-4-one |
| SMILES | COCCCn1c(SCc2cc(Cl)c3c(c2)OCCO3)nc2cc(Cl)ccc2c1=O |
| InChI | InChI=1S/C21H20Cl2N2O4S/c1-27-6-2-5-25-20(26)15-4-3-14(22)11-17(15)24-21(25)30-12-13-9-16(23)19-18(10-13)28-7-8-29-19/h3-4,9-11H,2,5-8,12H2,1H3 |
| InChIKey | ACLHBYNVZWWEIP-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.37 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|