C24H28ClN3O3S — CID 40948239
2-[7-chloro-4-oxo-3-(3-propan-2-yloxypropyl)quinazolin-2-yl]sulfanyl-N-ethyl-N-phenylacetamide (PubChem CID 40948239) has the molecular formula C24H28ClN3O3S and a molecular weight of 474.03 g/mol. Its IUPAC name is 2-[7-chloro-4-oxo-3-(3-propan-2-yloxypropyl)quinazolin-2-yl]sulfanyl-N-ethyl-N-phenylacetamide.
| Compound Name | 2-[7-chloro-4-oxo-3-(3-propan-2-yloxypropyl)quinazolin-2-yl]sulfanyl-N-ethyl-N-phenylacetamide |
|---|---|
| PubChem CID | 40948239 |
| Molecular Formula | C24H28ClN3O3S |
| Molecular Weight | 474.03 g/mol |
| Exact Mass | 473.15 |
| IUPAC Name | 2-[7-chloro-4-oxo-3-(3-propan-2-yloxypropyl)quinazolin-2-yl]sulfanyl-N-ethyl-N-phenylacetamide |
| SMILES | CCN(C(=O)CSc1nc2cc(Cl)ccc2c(=O)n1CCCOC(C)C)c1ccccc1 |
| InChI | InChI=1S/C24H28ClN3O3S/c1-4-27(19-9-6-5-7-10-19)22(29)16-32-24-26-21-15-18(25)11-12-20(21)23(30)28(24)13-8-14-31-17(2)3/h5-7,9-12,15,17H,4,8,13-14,16H2,1-3H3 |
| InChIKey | VFRKULJPMMBIDU-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.03 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|