C21H23ClN2O2S — CID 51365582
2-[(4-chlorophenyl)methylsulfanyl]-3-(3-propan-2-yloxypropyl)quinazolin-4-one (PubChem CID 51365582) has the molecular formula C21H23ClN2O2S and a molecular weight of 402.95 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methylsulfanyl]-3-(3-propan-2-yloxypropyl)quinazolin-4-one.
| Compound Name | 2-[(4-chlorophenyl)methylsulfanyl]-3-(3-propan-2-yloxypropyl)quinazolin-4-one |
|---|---|
| PubChem CID | 51365582 |
| Molecular Formula | C21H23ClN2O2S |
| Molecular Weight | 402.95 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | 2-[(4-chlorophenyl)methylsulfanyl]-3-(3-propan-2-yloxypropyl)quinazolin-4-one |
| SMILES | CC(C)OCCCn1c(SCc2ccc(Cl)cc2)nc2ccccc2c1=O |
| InChI | InChI=1S/C21H23ClN2O2S/c1-15(2)26-13-5-12-24-20(25)18-6-3-4-7-19(18)23-21(24)27-14-16-8-10-17(22)11-9-16/h3-4,6-11,15H,5,12-14H2,1-2H3 |
| InChIKey | YZFLMFBDLOLYBM-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.95 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|