C23H25Cl2N3O3S — CID 31225106
N-(3-chloro-2-methylphenyl)-2-[7-chloro-4-oxo-3-(3-propan-2-yloxypropyl)quinazolin-2-yl]sulfanylacetamide (PubChem CID 31225106) has the molecular formula C23H25Cl2N3O3S and a molecular weight of 494.44 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)-2-[7-chloro-4-oxo-3-(3-propan-2-yloxypropyl)quinazolin-2-yl]sulfanylacetamide.
| Compound Name | N-(3-chloro-2-methylphenyl)-2-[7-chloro-4-oxo-3-(3-propan-2-yloxypropyl)quinazolin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 31225106 |
| Molecular Formula | C23H25Cl2N3O3S |
| Molecular Weight | 494.44 g/mol |
| Exact Mass | 493.10 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)-2-[7-chloro-4-oxo-3-(3-propan-2-yloxypropyl)quinazolin-2-yl]sulfanylacetamide |
| SMILES | Cc1c(Cl)cccc1NC(=O)CSc1nc2cc(Cl)ccc2c(=O)n1CCCOC(C)C |
| InChI | InChI=1S/C23H25Cl2N3O3S/c1-14(2)31-11-5-10-28-22(30)17-9-8-16(24)12-20(17)27-23(28)32-13-21(29)26-19-7-4-6-18(25)15(19)3/h4,6-9,12,14H,5,10-11,13H2,1-3H3,(H,26,29) |
| InChIKey | XMPRAQQTTXTBOI-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.44 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|