C27H25FN2O4S — CID 41059438
2-[[(2S)-6-fluoro-2-phenyl-4H-1,3-benzodioxin-8-yl]methylsulfanyl]-3-(3-methoxypropyl)quinazolin-4-one (PubChem CID 41059438) has the molecular formula C27H25FN2O4S and a molecular weight of 492.57 g/mol. Its IUPAC name is 2-[[(2S)-6-fluoro-2-phenyl-4H-1,3-benzodioxin-8-yl]methylsulfanyl]-3-(3-methoxypropyl)quinazolin-4-one.
| Compound Name | 2-[[(2S)-6-fluoro-2-phenyl-4H-1,3-benzodioxin-8-yl]methylsulfanyl]-3-(3-methoxypropyl)quinazolin-4-one |
|---|---|
| PubChem CID | 41059438 |
| Molecular Formula | C27H25FN2O4S |
| Molecular Weight | 492.57 g/mol |
| Exact Mass | 492.15 |
| IUPAC Name | 2-[[(2S)-6-fluoro-2-phenyl-4H-1,3-benzodioxin-8-yl]methylsulfanyl]-3-(3-methoxypropyl)quinazolin-4-one |
| SMILES | COCCCn1c(SCc2cc(F)cc3c2O[C@@H](c2ccccc2)OC3)nc2ccccc2c1=O |
| InChI | InChI=1S/C27H25FN2O4S/c1-32-13-7-12-30-25(31)22-10-5-6-11-23(22)29-27(30)35-17-20-15-21(28)14-19-16-33-26(34-24(19)20)18-8-3-2-4-9-18/h2-6,8-11,14-15,26H,7,12-13,16-17H2,1H3/t26-/m0/s1 |
| InChIKey | ICAMBTYHINVXRZ-SANMLTNESA-N |
| XLogP | 5.47 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.57 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|