C21H18N2O4S — CID 29434924
3-ethyl-2-[(7-hydroxy-8-methyl-2-oxochromen-4-yl)methylsulfanyl]quinazolin-4-one (PubChem CID 29434924) has the molecular formula C21H18N2O4S and a molecular weight of 394.45 g/mol. Its IUPAC name is 3-ethyl-2-[(7-hydroxy-8-methyl-2-oxochromen-4-yl)methylsulfanyl]quinazolin-4-one.
| Compound Name | 3-ethyl-2-[(7-hydroxy-8-methyl-2-oxochromen-4-yl)methylsulfanyl]quinazolin-4-one |
|---|---|
| PubChem CID | 29434924 |
| Molecular Formula | C21H18N2O4S |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | 3-ethyl-2-[(7-hydroxy-8-methyl-2-oxochromen-4-yl)methylsulfanyl]quinazolin-4-one |
| SMILES | CCn1c(SCc2cc(=O)oc3c(C)c(O)ccc23)nc2ccccc2c1=O |
| InChI | InChI=1S/C21H18N2O4S/c1-3-23-20(26)15-6-4-5-7-16(15)22-21(23)28-11-13-10-18(25)27-19-12(2)17(24)9-8-14(13)19/h4-10,24H,3,11H2,1-2H3 |
| InChIKey | PGLIGLASFCGSPO-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|