C26H26N4O3S — CID 41432599
1-[(7,8-dimethyl-2-oxochromen-4-yl)methylsulfanyl]-4-pentyl-[1,2,4]triazolo[4,3-a]quinazolin-5-one (PubChem CID 41432599) has the molecular formula C26H26N4O3S and a molecular weight of 474.59 g/mol. Its IUPAC name is 1-[(7,8-dimethyl-2-oxochromen-4-yl)methylsulfanyl]-4-pentyl-[1,2,4]triazolo[4,3-a]quinazolin-5-one.
| Compound Name | 1-[(7,8-dimethyl-2-oxochromen-4-yl)methylsulfanyl]-4-pentyl-[1,2,4]triazolo[4,3-a]quinazolin-5-one |
|---|---|
| PubChem CID | 41432599 |
| Molecular Formula | C26H26N4O3S |
| Molecular Weight | 474.59 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | 1-[(7,8-dimethyl-2-oxochromen-4-yl)methylsulfanyl]-4-pentyl-[1,2,4]triazolo[4,3-a]quinazolin-5-one |
| SMILES | CCCCCn1c(=O)c2ccccc2n2c(SCc3cc(=O)oc4c(C)c(C)ccc34)nnc12 |
| InChI | InChI=1S/C26H26N4O3S/c1-4-5-8-13-29-24(32)20-9-6-7-10-21(20)30-25(29)27-28-26(30)34-15-18-14-22(31)33-23-17(3)16(2)11-12-19(18)23/h6-7,9-12,14H,4-5,8,13,15H2,1-3H3 |
| InChIKey | ZDVZTYWXUMWLPZ-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 82.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.59 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|