C26H28ClN3O2S — CID 3376016
4-[[5-(4-chlorophenyl)-4-hexyl-1,2,4-triazol-3-yl]sulfanylmethyl]-7,8-dimethylchromen-2-one (PubChem CID 3376016) has the molecular formula C26H28ClN3O2S and a molecular weight of 482.05 g/mol. Its IUPAC name is 4-[[5-(4-chlorophenyl)-4-hexyl-1,2,4-triazol-3-yl]sulfanylmethyl]-7,8-dimethylchromen-2-one.
| Compound Name | 4-[[5-(4-chlorophenyl)-4-hexyl-1,2,4-triazol-3-yl]sulfanylmethyl]-7,8-dimethylchromen-2-one |
|---|---|
| PubChem CID | 3376016 |
| Molecular Formula | C26H28ClN3O2S |
| Molecular Weight | 482.05 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | 4-[[5-(4-chlorophenyl)-4-hexyl-1,2,4-triazol-3-yl]sulfanylmethyl]-7,8-dimethylchromen-2-one |
| SMILES | CCCCCCn1c(SCc2cc(=O)oc3c(C)c(C)ccc23)nnc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H28ClN3O2S/c1-4-5-6-7-14-30-25(19-9-11-21(27)12-10-19)28-29-26(30)33-16-20-15-23(31)32-24-18(3)17(2)8-13-22(20)24/h8-13,15H,4-7,14,16H2,1-3H3 |
| InChIKey | RYTTZABEADDKTO-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 60.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.05 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|