C26H19ClN2O4S — CID 2451777
3-(3-chloro-4-methylphenyl)-2-[(7-methoxy-2-oxochromen-4-yl)methylsulfanyl]quinazolin-4-one (PubChem CID 2451777) has the molecular formula C26H19ClN2O4S and a molecular weight of 490.97 g/mol. Its IUPAC name is 3-(3-chloro-4-methylphenyl)-2-[(7-methoxy-2-oxochromen-4-yl)methylsulfanyl]quinazolin-4-one.
| Compound Name | 3-(3-chloro-4-methylphenyl)-2-[(7-methoxy-2-oxochromen-4-yl)methylsulfanyl]quinazolin-4-one |
|---|---|
| PubChem CID | 2451777 |
| Molecular Formula | C26H19ClN2O4S |
| Molecular Weight | 490.97 g/mol |
| Exact Mass | 490.08 |
| IUPAC Name | 3-(3-chloro-4-methylphenyl)-2-[(7-methoxy-2-oxochromen-4-yl)methylsulfanyl]quinazolin-4-one |
| SMILES | COc1ccc2c(CSc3nc4ccccc4c(=O)n3-c3ccc(C)c(Cl)c3)cc(=O)oc2c1 |
| InChI | InChI=1S/C26H19ClN2O4S/c1-15-7-8-17(12-21(15)27)29-25(31)20-5-3-4-6-22(20)28-26(29)34-14-16-11-24(30)33-23-13-18(32-2)9-10-19(16)23/h3-13H,14H2,1-2H3 |
| InChIKey | RCBRTDKTZQFKKB-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 74.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.97 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|