C18H13ClN2OS — CID 2569838
3-(3-chloro-4-methylphenyl)-2-prop-2-ynylsulfanylquinazolin-4-one (PubChem CID 2569838) has the molecular formula C18H13ClN2OS and a molecular weight of 340.84 g/mol. Its IUPAC name is 3-(3-chloro-4-methylphenyl)-2-prop-2-ynylsulfanylquinazolin-4-one.
| Compound Name | 3-(3-chloro-4-methylphenyl)-2-prop-2-ynylsulfanylquinazolin-4-one |
|---|---|
| PubChem CID | 2569838 |
| Molecular Formula | C18H13ClN2OS |
| Molecular Weight | 340.84 g/mol |
| Exact Mass | 340.04 |
| IUPAC Name | 3-(3-chloro-4-methylphenyl)-2-prop-2-ynylsulfanylquinazolin-4-one |
| SMILES | C#CCSc1nc2ccccc2c(=O)n1-c1ccc(C)c(Cl)c1 |
| InChI | InChI=1S/C18H13ClN2OS/c1-3-10-23-18-20-16-7-5-4-6-14(16)17(22)21(18)13-9-8-12(2)15(19)11-13/h1,4-9,11H,10H2,2H3 |
| InChIKey | YRBBDQFKDVAPMQ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.84 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|