C18H12ClFN4OS2 — CID 33113620
2-[(5-chlorothiadiazol-4-yl)methylsulfanyl]-3-(3-fluoro-4-methylphenyl)quinazolin-4-one (PubChem CID 33113620) has the molecular formula C18H12ClFN4OS2 and a molecular weight of 418.91 g/mol. Its IUPAC name is 2-[(5-chlorothiadiazol-4-yl)methylsulfanyl]-3-(3-fluoro-4-methylphenyl)quinazolin-4-one.
| Compound Name | 2-[(5-chlorothiadiazol-4-yl)methylsulfanyl]-3-(3-fluoro-4-methylphenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 33113620 |
| Molecular Formula | C18H12ClFN4OS2 |
| Molecular Weight | 418.91 g/mol |
| Exact Mass | 418.01 |
| IUPAC Name | 2-[(5-chlorothiadiazol-4-yl)methylsulfanyl]-3-(3-fluoro-4-methylphenyl)quinazolin-4-one |
| SMILES | Cc1ccc(-n2c(SCc3nnsc3Cl)nc3ccccc3c2=O)cc1F |
| InChI | InChI=1S/C18H12ClFN4OS2/c1-10-6-7-11(8-13(10)20)24-17(25)12-4-2-3-5-14(12)21-18(24)26-9-15-16(19)27-23-22-15/h2-8H,9H2,1H3 |
| InChIKey | WRBGXEFKKOKEAG-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.91 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |