C26H22N2O4S2 — CID 4802322
3-benzyl-2-[(7-methoxy-2-oxochromen-4-yl)methylsulfanyl]-5,6-dimethylthieno[2,3-d]pyrimidin-4-one (PubChem CID 4802322) has the molecular formula C26H22N2O4S2 and a molecular weight of 490.61 g/mol. Its IUPAC name is 3-benzyl-2-[(7-methoxy-2-oxochromen-4-yl)methylsulfanyl]-5,6-dimethylthieno[2,3-d]pyrimidin-4-one.
| Compound Name | 3-benzyl-2-[(7-methoxy-2-oxochromen-4-yl)methylsulfanyl]-5,6-dimethylthieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 4802322 |
| Molecular Formula | C26H22N2O4S2 |
| Molecular Weight | 490.61 g/mol |
| Exact Mass | 490.10 |
| IUPAC Name | 3-benzyl-2-[(7-methoxy-2-oxochromen-4-yl)methylsulfanyl]-5,6-dimethylthieno[2,3-d]pyrimidin-4-one |
| SMILES | COc1ccc2c(CSc3nc4sc(C)c(C)c4c(=O)n3Cc3ccccc3)cc(=O)oc2c1 |
| InChI | InChI=1S/C26H22N2O4S2/c1-15-16(2)34-24-23(15)25(30)28(13-17-7-5-4-6-8-17)26(27-24)33-14-18-11-22(29)32-21-12-19(31-3)9-10-20(18)21/h4-12H,13-14H2,1-3H3 |
| InChIKey | GLLABFIYPXMRNC-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 74.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.61 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|