C25H26N4O3S — CID 30515296
4-[[4-benzyl-5-(pyrrolidin-1-ylmethyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-7-methoxychromen-2-one (PubChem CID 30515296) has the molecular formula C25H26N4O3S and a molecular weight of 462.58 g/mol. Its IUPAC name is 4-[[4-benzyl-5-(pyrrolidin-1-ylmethyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-7-methoxychromen-2-one.
| Compound Name | 4-[[4-benzyl-5-(pyrrolidin-1-ylmethyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-7-methoxychromen-2-one |
|---|---|
| PubChem CID | 30515296 |
| Molecular Formula | C25H26N4O3S |
| Molecular Weight | 462.58 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | 4-[[4-benzyl-5-(pyrrolidin-1-ylmethyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-7-methoxychromen-2-one |
| SMILES | COc1ccc2c(CSc3nnc(CN4CCCC4)n3Cc3ccccc3)cc(=O)oc2c1 |
| InChI | InChI=1S/C25H26N4O3S/c1-31-20-9-10-21-19(13-24(30)32-22(21)14-20)17-33-25-27-26-23(16-28-11-5-6-12-28)29(25)15-18-7-3-2-4-8-18/h2-4,7-10,13-14H,5-6,11-12,15-17H2,1H3 |
| InChIKey | WTSJSHFMBKIEKB-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 73.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.58 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|