C30H29N3O2S — CID 2472951
4-[[4-benzyl-5-(4-tert-butylphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-7-methylchromen-2-one (PubChem CID 2472951) has the molecular formula C30H29N3O2S and a molecular weight of 495.65 g/mol. Its IUPAC name is 4-[[4-benzyl-5-(4-tert-butylphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-7-methylchromen-2-one.
| Compound Name | 4-[[4-benzyl-5-(4-tert-butylphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-7-methylchromen-2-one |
|---|---|
| PubChem CID | 2472951 |
| Molecular Formula | C30H29N3O2S |
| Molecular Weight | 495.65 g/mol |
| Exact Mass | 495.20 |
| IUPAC Name | 4-[[4-benzyl-5-(4-tert-butylphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-7-methylchromen-2-one |
| SMILES | Cc1ccc2c(CSc3nnc(-c4ccc(C(C)(C)C)cc4)n3Cc3ccccc3)cc(=O)oc2c1 |
| InChI | InChI=1S/C30H29N3O2S/c1-20-10-15-25-23(17-27(34)35-26(25)16-20)19-36-29-32-31-28(33(29)18-21-8-6-5-7-9-21)22-11-13-24(14-12-22)30(2,3)4/h5-17H,18-19H2,1-4H3 |
| InChIKey | XVKSOFVOITVKTL-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 60.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.65 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|