C26H21N3O2S — CID 155815431
6-methyl-4-[[5-(4-methylphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanylmethyl]chromen-2-one (PubChem CID 155815431) has the molecular formula C26H21N3O2S and a molecular weight of 439.54 g/mol. Its IUPAC name is 6-methyl-4-[[5-(4-methylphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanylmethyl]chromen-2-one.
| Compound Name | 6-methyl-4-[[5-(4-methylphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanylmethyl]chromen-2-one |
|---|---|
| PubChem CID | 155815431 |
| Molecular Formula | C26H21N3O2S |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | 6-methyl-4-[[5-(4-methylphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanylmethyl]chromen-2-one |
| SMILES | Cc1ccc(-c2nnc(SCc3cc(=O)oc4ccc(C)cc34)n2-c2ccccc2)cc1 |
| InChI | InChI=1S/C26H21N3O2S/c1-17-8-11-19(12-9-17)25-27-28-26(29(25)21-6-4-3-5-7-21)32-16-20-15-24(30)31-23-13-10-18(2)14-22(20)23/h3-15H,16H2,1-2H3 |
| InChIKey | OFNPEYWFEVKDNL-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 60.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|