C19H16N2O4S — CID 4571185
4-[(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)oxymethyl]-7-methoxychromen-2-one (PubChem CID 4571185) has the molecular formula C19H16N2O4S and a molecular weight of 368.41 g/mol. Its IUPAC name is 4-[(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)oxymethyl]-7-methoxychromen-2-one.
| Compound Name | 4-[(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)oxymethyl]-7-methoxychromen-2-one |
|---|---|
| PubChem CID | 4571185 |
| Molecular Formula | C19H16N2O4S |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | 4-[(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)oxymethyl]-7-methoxychromen-2-one |
| SMILES | COc1ccc2c(COc3ncnc4sc(C)c(C)c34)cc(=O)oc2c1 |
| InChI | InChI=1S/C19H16N2O4S/c1-10-11(2)26-19-17(10)18(20-9-21-19)24-8-12-6-16(22)25-15-7-13(23-3)4-5-14(12)15/h4-7,9H,8H2,1-3H3 |
| InChIKey | NVHMUKIZIBYJEF-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 74.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|