C20H16N2O6S — CID 7905068
(7-hydroxy-2-oxochromen-4-yl)methyl 2-(5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)acetate (PubChem CID 7905068) has the molecular formula C20H16N2O6S and a molecular weight of 412.42 g/mol. Its IUPAC name is (7-hydroxy-2-oxochromen-4-yl)methyl 2-(5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)acetate.
| Compound Name | (7-hydroxy-2-oxochromen-4-yl)methyl 2-(5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)acetate |
|---|---|
| PubChem CID | 7905068 |
| Molecular Formula | C20H16N2O6S |
| Molecular Weight | 412.42 g/mol |
| Exact Mass | 412.07 |
| IUPAC Name | (7-hydroxy-2-oxochromen-4-yl)methyl 2-(5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)acetate |
| SMILES | Cc1sc2ncn(CC(=O)OCc3cc(=O)oc4cc(O)ccc34)c(=O)c2c1C |
| InChI | InChI=1S/C20H16N2O6S/c1-10-11(2)29-19-18(10)20(26)22(9-21-19)7-17(25)27-8-12-5-16(24)28-15-6-13(23)3-4-14(12)15/h3-6,9,23H,7-8H2,1-2H3 |
| InChIKey | BRHVOZIDTYXXJT-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.42 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|