C21H21NO7 — CID 8979388
ethyl 1-[2-[(7-hydroxy-2-oxochromen-4-yl)methoxy]-2-oxoethyl]-2,5-dimethylpyrrole-3-carboxylate (PubChem CID 8979388) has the molecular formula C21H21NO7 and a molecular weight of 399.40 g/mol. Its IUPAC name is ethyl 1-[2-[(7-hydroxy-2-oxochromen-4-yl)methoxy]-2-oxoethyl]-2,5-dimethylpyrrole-3-carboxylate.
| Compound Name | ethyl 1-[2-[(7-hydroxy-2-oxochromen-4-yl)methoxy]-2-oxoethyl]-2,5-dimethylpyrrole-3-carboxylate |
|---|---|
| PubChem CID | 8979388 |
| Molecular Formula | C21H21NO7 |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | ethyl 1-[2-[(7-hydroxy-2-oxochromen-4-yl)methoxy]-2-oxoethyl]-2,5-dimethylpyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(C)n(CC(=O)OCc2cc(=O)oc3cc(O)ccc23)c1C |
| InChI | InChI=1S/C21H21NO7/c1-4-27-21(26)17-7-12(2)22(13(17)3)10-20(25)28-11-14-8-19(24)29-18-9-15(23)5-6-16(14)18/h5-9,23H,4,10-11H2,1-3H3 |
| InChIKey | MZWJIJCERSPVEC-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|