C17H15NO5S — CID 9320557
(7-methyl-2-oxochromen-4-yl)methyl 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetate (PubChem CID 9320557) has the molecular formula C17H15NO5S and a molecular weight of 345.38 g/mol. Its IUPAC name is (7-methyl-2-oxochromen-4-yl)methyl 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetate.
| Compound Name | (7-methyl-2-oxochromen-4-yl)methyl 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetate |
|---|---|
| PubChem CID | 9320557 |
| Molecular Formula | C17H15NO5S |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | (7-methyl-2-oxochromen-4-yl)methyl 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetate |
| SMILES | Cc1ccc2c(COC(=O)Cn3c(C)csc3=O)cc(=O)oc2c1 |
| InChI | InChI=1S/C17H15NO5S/c1-10-3-4-13-12(6-15(19)23-14(13)5-10)8-22-16(20)7-18-11(2)9-24-17(18)21/h3-6,9H,7-8H2,1-2H3 |
| InChIKey | SIMSCOJRWOZYDA-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 78.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|