C18H17NO6S — CID 8813123
(6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetate (PubChem CID 8813123) has the molecular formula C18H17NO6S and a molecular weight of 375.40 g/mol. Its IUPAC name is (6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetate.
| Compound Name | (6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetate |
|---|---|
| PubChem CID | 8813123 |
| Molecular Formula | C18H17NO6S |
| Molecular Weight | 375.40 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | (6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetate |
| SMILES | CCc1cc2c(COC(=O)Cn3c(C)csc3=O)cc(=O)oc2cc1O |
| InChI | InChI=1S/C18H17NO6S/c1-3-11-4-13-12(5-16(21)25-15(13)6-14(11)20)8-24-17(22)7-19-10(2)9-26-18(19)23/h4-6,9,20H,3,7-8H2,1-2H3 |
| InChIKey | DKEXYTHARZNDCY-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.40 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|