C22H19FO6 — CID 7967646
(6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl 4-(4-fluorophenyl)-4-oxobutanoate (PubChem CID 7967646) has the molecular formula C22H19FO6 and a molecular weight of 398.39 g/mol. Its IUPAC name is (6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl 4-(4-fluorophenyl)-4-oxobutanoate.
| Compound Name | (6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl 4-(4-fluorophenyl)-4-oxobutanoate |
|---|---|
| PubChem CID | 7967646 |
| Molecular Formula | C22H19FO6 |
| Molecular Weight | 398.39 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | (6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl 4-(4-fluorophenyl)-4-oxobutanoate |
| SMILES | CCc1cc2c(COC(=O)CCC(=O)c3ccc(F)cc3)cc(=O)oc2cc1O |
| InChI | InChI=1S/C22H19FO6/c1-2-13-9-17-15(10-22(27)29-20(17)11-19(13)25)12-28-21(26)8-7-18(24)14-3-5-16(23)6-4-14/h3-6,9-11,25H,2,7-8,12H2,1H3 |
| InChIKey | VHAUJVZFIUTZSX-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.39 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|