C21H20O5S — CID 7806600
(6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl (2R)-2-phenylsulfanylpropanoate (PubChem CID 7806600) has the molecular formula C21H20O5S and a molecular weight of 384.45 g/mol. Its IUPAC name is (6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl (2R)-2-phenylsulfanylpropanoate.
| Compound Name | (6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl (2R)-2-phenylsulfanylpropanoate |
|---|---|
| PubChem CID | 7806600 |
| Molecular Formula | C21H20O5S |
| Molecular Weight | 384.45 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | (6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl (2R)-2-phenylsulfanylpropanoate |
| SMILES | CCc1cc2c(COC(=O)[C@@H](C)Sc3ccccc3)cc(=O)oc2cc1O |
| InChI | InChI=1S/C21H20O5S/c1-3-14-9-17-15(10-20(23)26-19(17)11-18(14)22)12-25-21(24)13(2)27-16-7-5-4-6-8-16/h4-11,13,22H,3,12H2,1-2H3/t13-/m1/s1 |
| InChIKey | DXFLXMZLTYJTTI-CYBMUJFWSA-N |
| XLogP | 4.28 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.45 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|