C21H20O6 — CID 8791315
(6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl (2S)-2-phenoxypropanoate (PubChem CID 8791315) has the molecular formula C21H20O6 and a molecular weight of 368.39 g/mol. Its IUPAC name is (6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl (2S)-2-phenoxypropanoate.
| Compound Name | (6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl (2S)-2-phenoxypropanoate |
|---|---|
| PubChem CID | 8791315 |
| Molecular Formula | C21H20O6 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | (6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl (2S)-2-phenoxypropanoate |
| SMILES | CCc1cc2c(COC(=O)[C@H](C)Oc3ccccc3)cc(=O)oc2cc1O |
| InChI | InChI=1S/C21H20O6/c1-3-14-9-17-15(10-20(23)27-19(17)11-18(14)22)12-25-21(24)13(2)26-16-7-5-4-6-8-16/h4-11,13,22H,3,12H2,1-2H3/t13-/m0/s1 |
| InChIKey | VVCZGMZEKUOUGD-ZDUSSCGKSA-N |
| XLogP | 3.57 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|