C25H25NO7 — CID 25435161
(6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl (2S)-2-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]propanoate (PubChem CID 25435161) has the molecular formula C25H25NO7 and a molecular weight of 451.48 g/mol. Its IUPAC name is (6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl (2S)-2-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]propanoate.
| Compound Name | (6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl (2S)-2-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]propanoate |
|---|---|
| PubChem CID | 25435161 |
| Molecular Formula | C25H25NO7 |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | (6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl (2S)-2-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]propanoate |
| SMILES | CCc1cc2c(COC(=O)[C@H](C)NC(=O)/C=C/c3ccc(OC)cc3)cc(=O)oc2cc1O |
| InChI | InChI=1S/C25H25NO7/c1-4-17-11-20-18(12-24(29)33-22(20)13-21(17)27)14-32-25(30)15(2)26-23(28)10-7-16-5-8-19(31-3)9-6-16/h5-13,15,27H,4,14H2,1-3H3,(H,26,28)/b10-7+/t15-/m0/s1 |
| InChIKey | SFTJXVNTCSEVQU-VSGCLNPGSA-N |
| XLogP | 3.33 |
| TPSA | 115.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|