C21H20ClNO5 — CID 55927422
[2-(4-chlorophenyl)-2-oxoethyl] (2S)-2-[3-(4-methoxyphenyl)prop-2-enoylamino]propanoate (PubChem CID 55927422) has the molecular formula C21H20ClNO5 and a molecular weight of 401.85 g/mol. Its IUPAC name is [2-(4-chlorophenyl)-2-oxoethyl] (2S)-2-[3-(4-methoxyphenyl)prop-2-enoylamino]propanoate.
| Compound Name | [2-(4-chlorophenyl)-2-oxoethyl] (2S)-2-[3-(4-methoxyphenyl)prop-2-enoylamino]propanoate |
|---|---|
| PubChem CID | 55927422 |
| Molecular Formula | C21H20ClNO5 |
| Molecular Weight | 401.85 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | [2-(4-chlorophenyl)-2-oxoethyl] (2S)-2-[3-(4-methoxyphenyl)prop-2-enoylamino]propanoate |
| SMILES | COc1ccc(C=CC(=O)N[C@@H](C)C(=O)OCC(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C21H20ClNO5/c1-14(21(26)28-13-19(24)16-6-8-17(22)9-7-16)23-20(25)12-5-15-3-10-18(27-2)11-4-15/h3-12,14H,13H2,1-2H3,(H,23,25)/t14-/m0/s1 |
| InChIKey | WVVKTSIRNUUQQS-AWEZNQCLSA-N |
| XLogP | 3.29 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.85 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|