C21H26N2O5 — CID 7607594
[2-[bis(prop-2-enyl)amino]-2-oxoethyl] (2S)-2-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]propanoate (PubChem CID 7607594) has the molecular formula C21H26N2O5 and a molecular weight of 386.45 g/mol. Its IUPAC name is [2-[bis(prop-2-enyl)amino]-2-oxoethyl] (2S)-2-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]propanoate.
| Compound Name | [2-[bis(prop-2-enyl)amino]-2-oxoethyl] (2S)-2-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]propanoate |
|---|---|
| PubChem CID | 7607594 |
| Molecular Formula | C21H26N2O5 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | [2-[bis(prop-2-enyl)amino]-2-oxoethyl] (2S)-2-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]propanoate |
| SMILES | C=CCN(CC=C)C(=O)COC(=O)[C@H](C)NC(=O)/C=C/c1ccc(OC)cc1 |
| InChI | InChI=1S/C21H26N2O5/c1-5-13-23(14-6-2)20(25)15-28-21(26)16(3)22-19(24)12-9-17-7-10-18(27-4)11-8-17/h5-12,16H,1-2,13-15H2,3-4H3,(H,22,24)/b12-9+/t16-/m0/s1 |
| InChIKey | MCJQLEUEGCIYGH-YHVDPYDOSA-N |
| XLogP | 1.96 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|