C20H17ClO5 — CID 8579219
(6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl 2-(4-chlorophenyl)acetate (PubChem CID 8579219) has the molecular formula C20H17ClO5 and a molecular weight of 372.80 g/mol. Its IUPAC name is (6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl 2-(4-chlorophenyl)acetate.
| Compound Name | (6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl 2-(4-chlorophenyl)acetate |
|---|---|
| PubChem CID | 8579219 |
| Molecular Formula | C20H17ClO5 |
| Molecular Weight | 372.80 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | (6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl 2-(4-chlorophenyl)acetate |
| SMILES | CCc1cc2c(COC(=O)Cc3ccc(Cl)cc3)cc(=O)oc2cc1O |
| InChI | InChI=1S/C20H17ClO5/c1-2-13-8-16-14(9-20(24)26-18(16)10-17(13)22)11-25-19(23)7-12-3-5-15(21)6-4-12/h3-6,8-10,22H,2,7,11H2,1H3 |
| InChIKey | DSTJXJMHIWNHDS-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.80 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|