C22H23NO7 — CID 7940007
(6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl 2-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]acetate (PubChem CID 7940007) has the molecular formula C22H23NO7 and a molecular weight of 413.43 g/mol. Its IUPAC name is (6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl 2-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]acetate.
| Compound Name | (6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl 2-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]acetate |
|---|---|
| PubChem CID | 7940007 |
| Molecular Formula | C22H23NO7 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | (6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl 2-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]acetate |
| SMILES | CCc1cc2c(COC(=O)CN3C(=O)[C@@H]4CCCC[C@H]4C3=O)cc(=O)oc2cc1O |
| InChI | InChI=1S/C22H23NO7/c1-2-12-7-16-13(8-19(25)30-18(16)9-17(12)24)11-29-20(26)10-23-21(27)14-5-3-4-6-15(14)22(23)28/h7-9,14-15,24H,2-6,10-11H2,1H3/t14-,15-/m1/s1 |
| InChIKey | WWSQSGRMZOIBDZ-HUUCEWRRSA-N |
| XLogP | 2.28 |
| TPSA | 114.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|