C21H24O5 — CID 8753523
(6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl 2-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetate (PubChem CID 8753523) has the molecular formula C21H24O5 and a molecular weight of 356.42 g/mol. Its IUPAC name is (6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl 2-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetate.
| Compound Name | (6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl 2-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetate |
|---|---|
| PubChem CID | 8753523 |
| Molecular Formula | C21H24O5 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | (6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl 2-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetate |
| SMILES | CCc1cc2c(COC(=O)C[C@H]3C[C@H]4CC[C@H]3C4)cc(=O)oc2cc1O |
| InChI | InChI=1S/C21H24O5/c1-2-13-7-17-16(9-21(24)26-19(17)10-18(13)22)11-25-20(23)8-15-6-12-3-4-14(15)5-12/h7,9-10,12,14-15,22H,2-6,8,11H2,1H3/t12-,14-,15+/m0/s1 |
| InChIKey | WCKQZXBNVCHEBW-AEGPPILISA-N |
| XLogP | 3.93 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|