C21H23NO5 — CID 98412806
(7-acetamido-2-oxochromen-4-yl)methyl 2-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]acetate (PubChem CID 98412806) has the molecular formula C21H23NO5 and a molecular weight of 369.42 g/mol. Its IUPAC name is (7-acetamido-2-oxochromen-4-yl)methyl 2-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]acetate.
| Compound Name | (7-acetamido-2-oxochromen-4-yl)methyl 2-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]acetate |
|---|---|
| PubChem CID | 98412806 |
| Molecular Formula | C21H23NO5 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | (7-acetamido-2-oxochromen-4-yl)methyl 2-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]acetate |
| SMILES | CC(=O)Nc1ccc2c(COC(=O)C[C@@H]3C[C@@H]4CC[C@@H]3C4)cc(=O)oc2c1 |
| InChI | InChI=1S/C21H23NO5/c1-12(23)22-17-4-5-18-16(9-21(25)27-19(18)10-17)11-26-20(24)8-15-7-13-2-3-14(15)6-13/h4-5,9-10,13-15H,2-3,6-8,11H2,1H3,(H,22,23)/t13-,14-,15+/m1/s1 |
| InChIKey | XLYVLUBSJMDEFQ-KFWWJZLASA-N |
| XLogP | 3.62 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|