About (7-acetamido-2-oxochromen-4-yl)methyl 3-[(2R)-2-methyl-3-oxo-1,4-benzoxazin-4-yl]propanoate
(7-acetamido-2-oxochromen-4-yl)methyl 3-[(2R)-2-methyl-3-oxo-1,4-benzoxazin-4-yl]propanoate (PubChem CID 94732870) has the molecular formula C24H22N2O7
and a molecular weight of 450.45 g/mol. Its IUPAC name is (7-acetamido-2-oxochromen-4-yl)methyl 3-[(2R)-2-methyl-3-oxo-1,4-benzoxazin-4-yl]propanoate.
Molecular Properties
| Compound Name | (7-acetamido-2-oxochromen-4-yl)methyl 3-[(2R)-2-methyl-3-oxo-1,4-benzoxazin-4-yl]propanoate |
| PubChem CID | 94732870 |
| Molecular Formula | C24H22N2O7 |
| Molecular Weight | 450.45 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | (7-acetamido-2-oxochromen-4-yl)methyl 3-[(2R)-2-methyl-3-oxo-1,4-benzoxazin-4-yl]propanoate |
| SMILES | CC(=O)Nc1ccc2c(COC(=O)CCN3C(=O)[C@@H](C)Oc4ccccc43)cc(=O)oc2c1 |
| InChI | InChI=1S/C24H22N2O7/c1-14-24(30)26(19-5-3-4-6-20(19)32-14)10-9-22(28)31-13-16-11-23(29)33-21-12-17(25-15(2)27)7-8-18(16)21/h3-8,11-12,14H,9-10,13H2,1-2H3,(H,25,27)/t14-/m1/s1 |
| InChIKey | KPQGZMXHXQBBSB-CQSZACIVSA-N |
| XLogP | 3.00 |
| TPSA | 115.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 450.45 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze (7-acetamido-2-oxochromen-4-yl)methyl 3-[(2R)-2-methyl-3-oxo-1,4-benzoxazin-4-yl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-acetamido-2-oxochromen-4-yl)methyl 3-[(2R)-2-methyl-3-oxo-1,4-benzoxazin-4-yl]propanoate?
The IUPAC name of (7-acetamido-2-oxochromen-4-yl)methyl 3-[(2R)-2-methyl-3-oxo-1,4-benzoxazin-4-yl]propanoate (CID 94732870) is (7-acetamido-2-oxochromen-4-yl)methyl 3-[(2R)-2-methyl-3-oxo-1,4-benzoxazin-4-yl]propanoate.
What is the SMILES notation for (7-acetamido-2-oxochromen-4-yl)methyl 3-[(2R)-2-methyl-3-oxo-1,4-benzoxazin-4-yl]propanoate?
The canonical SMILES for (7-acetamido-2-oxochromen-4-yl)methyl 3-[(2R)-2-methyl-3-oxo-1,4-benzoxazin-4-yl]propanoate is CC(=O)Nc1ccc2c(COC(=O)CCN3C(=O)[C@@H](C)Oc4ccccc43)cc(=O)oc2c1.
What is the InChIKey of (7-acetamido-2-oxochromen-4-yl)methyl 3-[(2R)-2-methyl-3-oxo-1,4-benzoxazin-4-yl]propanoate?
The InChIKey is KPQGZMXHXQBBSB-CQSZACIVSA-N. The full InChI is InChI=1S/C24H22N2O7/c1-14-24(30)26(19-5-3-4-6-20(19)32-14)10-9-22(28)31-13-16-11-23(29)33-21-12-17(25-15(2)27)7-8-18(16)21/h3-8,11-12,14H,9-10,13H2,1-2H3,(H,25,27)/t14-/m1/s1.
What are the key properties of (7-acetamido-2-oxochromen-4-yl)methyl 3-[(2R)-2-methyl-3-oxo-1,4-benzoxazin-4-yl]propanoate?
(7-acetamido-2-oxochromen-4-yl)methyl 3-[(2R)-2-methyl-3-oxo-1,4-benzoxazin-4-yl]propanoate has a molecular weight of 450.45 g/mol, XLogP of 3.00, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (7-acetamido-2-oxochromen-4-yl)methyl 3-[(2R)-2-methyl-3-oxo-1,4-benzoxazin-4-yl]propanoate is sourced from PubChem (CID 94732870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).