C27H22N2O5S — CID 2483720
(7-acetamido-2-oxochromen-4-yl)methyl 3-phenothiazin-10-ylpropanoate (PubChem CID 2483720) has the molecular formula C27H22N2O5S and a molecular weight of 486.55 g/mol. Its IUPAC name is (7-acetamido-2-oxochromen-4-yl)methyl 3-phenothiazin-10-ylpropanoate.
| Compound Name | (7-acetamido-2-oxochromen-4-yl)methyl 3-phenothiazin-10-ylpropanoate |
|---|---|
| PubChem CID | 2483720 |
| Molecular Formula | C27H22N2O5S |
| Molecular Weight | 486.55 g/mol |
| Exact Mass | 486.12 |
| IUPAC Name | (7-acetamido-2-oxochromen-4-yl)methyl 3-phenothiazin-10-ylpropanoate |
| SMILES | CC(=O)Nc1ccc2c(COC(=O)CCN3c4ccccc4Sc4ccccc43)cc(=O)oc2c1 |
| InChI | InChI=1S/C27H22N2O5S/c1-17(30)28-19-10-11-20-18(14-27(32)34-23(20)15-19)16-33-26(31)12-13-29-21-6-2-4-8-24(21)35-25-9-5-3-7-22(25)29/h2-11,14-15H,12-13,16H2,1H3,(H,28,30) |
| InChIKey | UJVIKUNUBSLTFW-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.55 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|