C23H22N2O7S — CID 16570815
(7-acetamido-2-oxochromen-4-yl)methyl 3-[(4-oxo-4-thiophen-2-ylbutanoyl)amino]propanoate (PubChem CID 16570815) has the molecular formula C23H22N2O7S and a molecular weight of 470.50 g/mol. Its IUPAC name is (7-acetamido-2-oxochromen-4-yl)methyl 3-[(4-oxo-4-thiophen-2-ylbutanoyl)amino]propanoate.
| Compound Name | (7-acetamido-2-oxochromen-4-yl)methyl 3-[(4-oxo-4-thiophen-2-ylbutanoyl)amino]propanoate |
|---|---|
| PubChem CID | 16570815 |
| Molecular Formula | C23H22N2O7S |
| Molecular Weight | 470.50 g/mol |
| Exact Mass | 470.11 |
| IUPAC Name | (7-acetamido-2-oxochromen-4-yl)methyl 3-[(4-oxo-4-thiophen-2-ylbutanoyl)amino]propanoate |
| SMILES | CC(=O)Nc1ccc2c(COC(=O)CCNC(=O)CCC(=O)c3cccs3)cc(=O)oc2c1 |
| InChI | InChI=1S/C23H22N2O7S/c1-14(26)25-16-4-5-17-15(11-23(30)32-19(17)12-16)13-31-22(29)8-9-24-21(28)7-6-18(27)20-3-2-10-33-20/h2-5,10-12H,6-9,13H2,1H3,(H,24,28)(H,25,26) |
| InChIKey | APMAWABTLAOSEB-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 131.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.50 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|