C26H24N2O6S — CID 24519805
[2-(4-benzamidophenyl)-2-oxoethyl] 3-[(4-oxo-4-thiophen-2-ylbutanoyl)amino]propanoate (PubChem CID 24519805) has the molecular formula C26H24N2O6S and a molecular weight of 492.55 g/mol. Its IUPAC name is [2-(4-benzamidophenyl)-2-oxoethyl] 3-[(4-oxo-4-thiophen-2-ylbutanoyl)amino]propanoate.
| Compound Name | [2-(4-benzamidophenyl)-2-oxoethyl] 3-[(4-oxo-4-thiophen-2-ylbutanoyl)amino]propanoate |
|---|---|
| PubChem CID | 24519805 |
| Molecular Formula | C26H24N2O6S |
| Molecular Weight | 492.55 g/mol |
| Exact Mass | 492.14 |
| IUPAC Name | [2-(4-benzamidophenyl)-2-oxoethyl] 3-[(4-oxo-4-thiophen-2-ylbutanoyl)amino]propanoate |
| SMILES | O=C(CCC(=O)c1cccs1)NCCC(=O)OCC(=O)c1ccc(NC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H24N2O6S/c29-21(23-7-4-16-35-23)12-13-24(31)27-15-14-25(32)34-17-22(30)18-8-10-20(11-9-18)28-26(33)19-5-2-1-3-6-19/h1-11,16H,12-15,17H2,(H,27,31)(H,28,33) |
| InChIKey | OOPWSTAYXZMTDD-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.55 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |