C19H17NO6 — CID 18076997
(7-acetamido-2-oxochromen-4-yl)methyl 2,5-dimethylfuran-3-carboxylate (PubChem CID 18076997) has the molecular formula C19H17NO6 and a molecular weight of 355.35 g/mol. Its IUPAC name is (7-acetamido-2-oxochromen-4-yl)methyl 2,5-dimethylfuran-3-carboxylate.
| Compound Name | (7-acetamido-2-oxochromen-4-yl)methyl 2,5-dimethylfuran-3-carboxylate |
|---|---|
| PubChem CID | 18076997 |
| Molecular Formula | C19H17NO6 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | (7-acetamido-2-oxochromen-4-yl)methyl 2,5-dimethylfuran-3-carboxylate |
| SMILES | CC(=O)Nc1ccc2c(COC(=O)c3cc(C)oc3C)cc(=O)oc2c1 |
| InChI | InChI=1S/C19H17NO6/c1-10-6-16(11(2)25-10)19(23)24-9-13-7-18(22)26-17-8-14(20-12(3)21)4-5-15(13)17/h4-8H,9H2,1-3H3,(H,20,21) |
| InChIKey | RZNTYRFMJDQGSX-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 98.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|