C26H18N2O5S — CID 2423244
(7-acetamido-2-oxochromen-4-yl)methyl 2-(2-cyanophenyl)sulfanylbenzoate (PubChem CID 2423244) has the molecular formula C26H18N2O5S and a molecular weight of 470.51 g/mol. Its IUPAC name is (7-acetamido-2-oxochromen-4-yl)methyl 2-(2-cyanophenyl)sulfanylbenzoate.
| Compound Name | (7-acetamido-2-oxochromen-4-yl)methyl 2-(2-cyanophenyl)sulfanylbenzoate |
|---|---|
| PubChem CID | 2423244 |
| Molecular Formula | C26H18N2O5S |
| Molecular Weight | 470.51 g/mol |
| Exact Mass | 470.09 |
| IUPAC Name | (7-acetamido-2-oxochromen-4-yl)methyl 2-(2-cyanophenyl)sulfanylbenzoate |
| SMILES | CC(=O)Nc1ccc2c(COC(=O)c3ccccc3Sc3ccccc3C#N)cc(=O)oc2c1 |
| InChI | InChI=1S/C26H18N2O5S/c1-16(29)28-19-10-11-20-18(12-25(30)33-22(20)13-19)15-32-26(31)21-7-3-5-9-24(21)34-23-8-4-2-6-17(23)14-27/h2-13H,15H2,1H3,(H,28,29) |
| InChIKey | YDNCIORLUZCFMN-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 109.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.51 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|