C21H19F3N2O5 — CID 42920985
(7-acetamido-2-oxochromen-4-yl)methyl 2,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrrole-3-carboxylate (PubChem CID 42920985) has the molecular formula C21H19F3N2O5 and a molecular weight of 436.39 g/mol. Its IUPAC name is (7-acetamido-2-oxochromen-4-yl)methyl 2,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrrole-3-carboxylate.
| Compound Name | (7-acetamido-2-oxochromen-4-yl)methyl 2,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 42920985 |
| Molecular Formula | C21H19F3N2O5 |
| Molecular Weight | 436.39 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | (7-acetamido-2-oxochromen-4-yl)methyl 2,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrrole-3-carboxylate |
| SMILES | CC(=O)Nc1ccc2c(COC(=O)c3cc(C)n(CC(F)(F)F)c3C)cc(=O)oc2c1 |
| InChI | InChI=1S/C21H19F3N2O5/c1-11-6-17(12(2)26(11)10-21(22,23)24)20(29)30-9-14-7-19(28)31-18-8-15(25-13(3)27)4-5-16(14)18/h4-8H,9-10H2,1-3H3,(H,25,27) |
| InChIKey | USVXEVMXOLJOIO-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.39 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|