C23H21NO6 — CID 94741270
(7-acetamido-2-oxochromen-4-yl)methyl (2S,3R)-2,3-dimethyl-2,3-dihydro-1-benzofuran-7-carboxylate (PubChem CID 94741270) has the molecular formula C23H21NO6 and a molecular weight of 407.42 g/mol. Its IUPAC name is (7-acetamido-2-oxochromen-4-yl)methyl (2S,3R)-2,3-dimethyl-2,3-dihydro-1-benzofuran-7-carboxylate.
| Compound Name | (7-acetamido-2-oxochromen-4-yl)methyl (2S,3R)-2,3-dimethyl-2,3-dihydro-1-benzofuran-7-carboxylate |
|---|---|
| PubChem CID | 94741270 |
| Molecular Formula | C23H21NO6 |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | (7-acetamido-2-oxochromen-4-yl)methyl (2S,3R)-2,3-dimethyl-2,3-dihydro-1-benzofuran-7-carboxylate |
| SMILES | CC(=O)Nc1ccc2c(COC(=O)c3cccc4c3O[C@@H](C)[C@@H]4C)cc(=O)oc2c1 |
| InChI | InChI=1S/C23H21NO6/c1-12-13(2)29-22-17(12)5-4-6-19(22)23(27)28-11-15-9-21(26)30-20-10-16(24-14(3)25)7-8-18(15)20/h4-10,12-13H,11H2,1-3H3,(H,24,25)/t12-,13-/m0/s1 |
| InChIKey | VQRRIYNZXXUYLO-STQMWFEESA-N |
| XLogP | 3.99 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|