C23H19NO6S — CID 2553210
(7-acetamido-2-oxochromen-4-yl)methyl 3-(methylsulfanylmethyl)-1-benzofuran-2-carboxylate (PubChem CID 2553210) has the molecular formula C23H19NO6S and a molecular weight of 437.47 g/mol. Its IUPAC name is (7-acetamido-2-oxochromen-4-yl)methyl 3-(methylsulfanylmethyl)-1-benzofuran-2-carboxylate.
| Compound Name | (7-acetamido-2-oxochromen-4-yl)methyl 3-(methylsulfanylmethyl)-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 2553210 |
| Molecular Formula | C23H19NO6S |
| Molecular Weight | 437.47 g/mol |
| Exact Mass | 437.09 |
| IUPAC Name | (7-acetamido-2-oxochromen-4-yl)methyl 3-(methylsulfanylmethyl)-1-benzofuran-2-carboxylate |
| SMILES | CSCc1c(C(=O)OCc2cc(=O)oc3cc(NC(C)=O)ccc23)oc2ccccc12 |
| InChI | InChI=1S/C23H19NO6S/c1-13(25)24-15-7-8-16-14(9-21(26)29-20(16)10-15)11-28-23(27)22-18(12-31-2)17-5-3-4-6-19(17)30-22/h3-10H,11-12H2,1-2H3,(H,24,25) |
| InChIKey | GUQHVVDGJCTIOI-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 98.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.47 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|