C23H21NO7 — CID 46648793
(7-methoxy-2-oxochromen-4-yl)methyl 3-(2-methyl-3-oxo-1,4-benzoxazin-4-yl)propanoate (PubChem CID 46648793) has the molecular formula C23H21NO7 and a molecular weight of 423.42 g/mol. Its IUPAC name is (7-methoxy-2-oxochromen-4-yl)methyl 3-(2-methyl-3-oxo-1,4-benzoxazin-4-yl)propanoate.
| Compound Name | (7-methoxy-2-oxochromen-4-yl)methyl 3-(2-methyl-3-oxo-1,4-benzoxazin-4-yl)propanoate |
|---|---|
| PubChem CID | 46648793 |
| Molecular Formula | C23H21NO7 |
| Molecular Weight | 423.42 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | (7-methoxy-2-oxochromen-4-yl)methyl 3-(2-methyl-3-oxo-1,4-benzoxazin-4-yl)propanoate |
| SMILES | COc1ccc2c(COC(=O)CCN3C(=O)C(C)Oc4ccccc43)cc(=O)oc2c1 |
| InChI | InChI=1S/C23H21NO7/c1-14-23(27)24(18-5-3-4-6-19(18)30-14)10-9-21(25)29-13-15-11-22(26)31-20-12-16(28-2)7-8-17(15)20/h3-8,11-12,14H,9-10,13H2,1-2H3 |
| InChIKey | CEQQANDFSLHXJP-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 95.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.42 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|