C25H23NO5 — CID 16572660
(4-phenylmethoxyphenyl) 3-(2-methyl-3-oxo-1,4-benzoxazin-4-yl)propanoate (PubChem CID 16572660) has the molecular formula C25H23NO5 and a molecular weight of 417.46 g/mol. Its IUPAC name is (4-phenylmethoxyphenyl) 3-(2-methyl-3-oxo-1,4-benzoxazin-4-yl)propanoate.
| Compound Name | (4-phenylmethoxyphenyl) 3-(2-methyl-3-oxo-1,4-benzoxazin-4-yl)propanoate |
|---|---|
| PubChem CID | 16572660 |
| Molecular Formula | C25H23NO5 |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | (4-phenylmethoxyphenyl) 3-(2-methyl-3-oxo-1,4-benzoxazin-4-yl)propanoate |
| SMILES | CC1Oc2ccccc2N(CCC(=O)Oc2ccc(OCc3ccccc3)cc2)C1=O |
| InChI | InChI=1S/C25H23NO5/c1-18-25(28)26(22-9-5-6-10-23(22)30-18)16-15-24(27)31-21-13-11-20(12-14-21)29-17-19-7-3-2-4-8-19/h2-14,18H,15-17H2,1H3 |
| InChIKey | WICLUOOEGQYGMK-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|