C24H24N2O6 — CID 42923619
4-(1,3-dioxoisoindol-2-yl)butyl 3-(2-methyl-3-oxo-1,4-benzoxazin-4-yl)propanoate (PubChem CID 42923619) has the molecular formula C24H24N2O6 and a molecular weight of 436.46 g/mol. Its IUPAC name is 4-(1,3-dioxoisoindol-2-yl)butyl 3-(2-methyl-3-oxo-1,4-benzoxazin-4-yl)propanoate.
| Compound Name | 4-(1,3-dioxoisoindol-2-yl)butyl 3-(2-methyl-3-oxo-1,4-benzoxazin-4-yl)propanoate |
|---|---|
| PubChem CID | 42923619 |
| Molecular Formula | C24H24N2O6 |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | 4-(1,3-dioxoisoindol-2-yl)butyl 3-(2-methyl-3-oxo-1,4-benzoxazin-4-yl)propanoate |
| SMILES | CC1Oc2ccccc2N(CCC(=O)OCCCCN2C(=O)c3ccccc3C2=O)C1=O |
| InChI | InChI=1S/C24H24N2O6/c1-16-22(28)25(19-10-4-5-11-20(19)32-16)14-12-21(27)31-15-7-6-13-26-23(29)17-8-2-3-9-18(17)24(26)30/h2-5,8-11,16H,6-7,12-15H2,1H3 |
| InChIKey | IGWLRPIBGBLONJ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|