C17H21NO6 — CID 101261137
ethyl 4-(4-ethoxy-4-oxobutyl)-3-oxo-1,4-benzoxazine-2-carboxylate (PubChem CID 101261137) has the molecular formula C17H21NO6 and a molecular weight of 335.36 g/mol. Its IUPAC name is ethyl 4-(4-ethoxy-4-oxobutyl)-3-oxo-1,4-benzoxazine-2-carboxylate.
| Compound Name | ethyl 4-(4-ethoxy-4-oxobutyl)-3-oxo-1,4-benzoxazine-2-carboxylate |
|---|---|
| PubChem CID | 101261137 |
| Molecular Formula | C17H21NO6 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | ethyl 4-(4-ethoxy-4-oxobutyl)-3-oxo-1,4-benzoxazine-2-carboxylate |
| SMILES | CCOC(=O)CCCN1C(=O)C(C(=O)OCC)Oc2ccccc21 |
| InChI | InChI=1S/C17H21NO6/c1-3-22-14(19)10-7-11-18-12-8-5-6-9-13(12)24-15(16(18)20)17(21)23-4-2/h5-6,8-9,15H,3-4,7,10-11H2,1-2H3 |
| InChIKey | YLGPWBOJTZNZQD-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|