C11H11NO3 — CID 138973688
ethyl (1R,1aS)-1,1a-dihydroazirino[2,1-b][1,3]benzoxazole-1-carboxylate (PubChem CID 138973688) has the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. Its IUPAC name is ethyl (1R,1aS)-1,1a-dihydroazirino[2,1-b][1,3]benzoxazole-1-carboxylate.
| Compound Name | ethyl (1R,1aS)-1,1a-dihydroazirino[2,1-b][1,3]benzoxazole-1-carboxylate |
|---|---|
| PubChem CID | 138973688 |
| Molecular Formula | C11H11NO3 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | ethyl (1R,1aS)-1,1a-dihydroazirino[2,1-b][1,3]benzoxazole-1-carboxylate |
| SMILES | CCOC(=O)[C@H]1[C@@H]2Oc3ccccc3N21 |
| InChI | InChI=1S/C11H11NO3/c1-2-14-11(13)9-10-12(9)7-5-3-4-6-8(7)15-10/h3-6,9-10H,2H2,1H3/t9-,10+,12?/m1/s1 |
| InChIKey | VOKHCIWQRDOHRK-WFCWDVHWSA-N |
| XLogP | 1.16 |
| TPSA | 38.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|