C13H15NO4 — CID 13425083
ethyl 4-acetyl-2,3-dihydro-1,4-benzoxazine-2-carboxylate (PubChem CID 13425083) has the molecular formula C13H15NO4 and a molecular weight of 249.27 g/mol. Its IUPAC name is ethyl 4-acetyl-2,3-dihydro-1,4-benzoxazine-2-carboxylate.
| Compound Name | ethyl 4-acetyl-2,3-dihydro-1,4-benzoxazine-2-carboxylate |
|---|---|
| PubChem CID | 13425083 |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | ethyl 4-acetyl-2,3-dihydro-1,4-benzoxazine-2-carboxylate |
| SMILES | CCOC(=O)C1CN(C(C)=O)c2ccccc2O1 |
| InChI | InChI=1S/C13H15NO4/c1-3-17-13(16)12-8-14(9(2)15)10-6-4-5-7-11(10)18-12/h4-7,12H,3,8H2,1-2H3 |
| InChIKey | IHSDNKASIZBOCZ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |